Products 1039821-17-4
CAS 1039821-17-4 appears in our catalog under these names: 2-((2-Bromophenoxy)methyl)-1,3-dichlorobenzene, 98%, 98%, 2-Bromophenyl-(2,6-dichlorobenzyl)ether, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-[(2-bromophenoxy)methyl]-1,3-dichlorobenzene (CAS 1039821-17-4) is a chemical compound with the molecular formula C13H9BrCl2O and a molecular weight of 332.0 g/mol. IUPAC name: 2-[(2-bromophenoxy)methyl]-1,3-dichlorobenzene. InChIKey: LPCXUWOFMQVIMU-UHFFFAOYSA-N.
| Molecular formula | C13H9BrCl2O |
|---|---|
| Molecular weight | 332.0 g/mol |
| IUPAC name | 2-[(2-bromophenoxy)methyl]-1,3-dichlorobenzene |
| InChIKey | LPCXUWOFMQVIMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC2=C(C=CC=C2Cl)Cl)Br |
Computed by PubChem (NCBI)