CAS 155891-94-4 appears in our catalog under these names: 2-(Benzyloxy)-5-bromo-1,3-dichlorobenzene, 98%, 2-(Benzyloxy)-5-bromo-1,3-dichlorobenzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 100g, 5g, 1g.
5-bromo-1,3-dichloro-2-phenylmethoxybenzene (CAS 155891-94-4) is a chemical compound with the molecular formula C13H9BrCl2O and a molecular weight of 332.0 g/mol. IUPAC name: 5-bromo-1,3-dichloro-2-phenylmethoxybenzene. InChIKey: IFBZRCLFOBNPKB-UHFFFAOYSA-N.
| Molecular formula | C13H9BrCl2O |
|---|---|
| Molecular weight | 332.0 g/mol |
| IUPAC name | 5-bromo-1,3-dichloro-2-phenylmethoxybenzene |
| InChIKey | IFBZRCLFOBNPKB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Cl)Br)Cl |
Computed by PubChem (NCBI)