CAS 1040313-76-5 is the registry number for 4-(2-Bromophenoxymethyl)-1,2-dichlorobenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-[(2-bromophenoxy)methyl]-1,2-dichlorobenzene (CAS 1040313-76-5) is a chemical compound with the molecular formula C13H9BrCl2O and a molecular weight of 332.0 g/mol. IUPAC name: 4-[(2-bromophenoxy)methyl]-1,2-dichlorobenzene. InChIKey: AFJOJSPBFFMACK-UHFFFAOYSA-N.
| Molecular formula | C13H9BrCl2O |
|---|---|
| Molecular weight | 332.0 g/mol |
| IUPAC name | 4-[(2-bromophenoxy)methyl]-1,2-dichlorobenzene |
| InChIKey | AFJOJSPBFFMACK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC2=CC(=C(C=C2)Cl)Cl)Br |
Computed by PubChem (NCBI)