CAS 2624417-12-3 is the registry number for 2-(Benzyloxy)-1-bromo-3,5-dichlorobenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-bromo-3,5-dichloro-2-phenylmethoxybenzene (CAS 2624417-12-3) is a chemical compound with the molecular formula C13H9BrCl2O and a molecular weight of 332.0 g/mol. IUPAC name: 1-bromo-3,5-dichloro-2-phenylmethoxybenzene. InChIKey: IJNNUUCKPHTQOP-UHFFFAOYSA-N.
| Molecular formula | C13H9BrCl2O |
|---|---|
| Molecular weight | 332.0 g/mol |
| IUPAC name | 1-bromo-3,5-dichloro-2-phenylmethoxybenzene |
| InChIKey | IJNNUUCKPHTQOP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Br)Cl)Cl |
Computed by PubChem (NCBI)