CAS 207238-25-3 is the registry number for 1-(Benzyloxy)-4-bromo-2,3-dichlorobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-2,3-dichloro-4-phenylmethoxybenzene (CAS 207238-25-3) is a chemical compound with the molecular formula C13H9BrCl2O and a molecular weight of 332.0 g/mol. IUPAC name: 1-bromo-2,3-dichloro-4-phenylmethoxybenzene. InChIKey: AADMLMGSZDWMGW-UHFFFAOYSA-N.
| Molecular formula | C13H9BrCl2O |
|---|---|
| Molecular weight | 332.0 g/mol |
| IUPAC name | 1-bromo-2,3-dichloro-4-phenylmethoxybenzene |
| InChIKey | AADMLMGSZDWMGW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)Br)Cl)Cl |
Computed by PubChem (NCBI)