CAS 103983-94-4 is the registry number for 2-(Quinolin-6-yl)acetonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-quinolin-6-ylacetonitrile (CAS 103983-94-4) is a chemical compound with the molecular formula C11H8N2 and a molecular weight of 168.19 g/mol. IUPAC name: 2-quinolin-6-ylacetonitrile. InChIKey: SGSMUSDVKCMDGR-UHFFFAOYSA-N.
| Molecular formula | C11H8N2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 2-quinolin-6-ylacetonitrile |
| InChIKey | SGSMUSDVKCMDGR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)CC#N)N=C1 |
Computed by PubChem (NCBI)