Products 103986-73-8
CAS 103986-73-8 appears in our catalog under these names: Trans-3-ethoxycinnamic acid, 95%, 3-(3-Ethoxyphenyl)acrylic acid, 95%, 3-Ethoxycinnamic acid, Trans-3-ethoxycinnamic acid, 99%(GC-MS),RG, 99%(GC-MS),RG, (2E)-3-(3-ethoxyphenyl)acrylic acid. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 25g, 50g, 100g, 250g.
3-(3-ethoxyphenyl)prop-2-enoic acid (CAS 103986-73-8) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 3-(3-ethoxyphenyl)prop-2-enoic acid. InChIKey: DOEYODSOYOGJQH-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 3-(3-ethoxyphenyl)prop-2-enoic acid |
| InChIKey | DOEYODSOYOGJQH-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC(=C1)C=CC(=O)O |
Computed by PubChem (NCBI)