CAS 1039878-71-1 appears in our catalog under these names: 2-Amino-4-chloro-3-fluorobenzoic acid, 95%, 2-amino-4-chloro-3-fluorobenzoic acid. Offered by: Combi-blocks, Chemat Brand, Biosynth. Available pack sizes: 250mg, 1g, on request, 100mg.
2-amino-4-chloro-3-fluorobenzoic acid (CAS 1039878-71-1) is a chemical compound with the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. IUPAC name: 2-amino-4-chloro-3-fluorobenzoic acid. InChIKey: AHROQQNUCNZNTI-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO2 |
|---|---|
| Molecular weight | 189.57 g/mol |
| IUPAC name | 2-amino-4-chloro-3-fluorobenzoic acid |
| InChIKey | AHROQQNUCNZNTI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)N)F)Cl |
Computed by PubChem (NCBI)