CAS 1039933-69-1 is the registry number for N-(3-Amino-4-methylphenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
N-(3-amino-4-methylphenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide (CAS 1039933-69-1) is a chemical compound with the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. IUPAC name: N-(3-amino-4-methylphenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide. InChIKey: MFQAWAUKKKUROS-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O3 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | N-(3-amino-4-methylphenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| InChIKey | MFQAWAUKKKUROS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC3=C(C=C2)OCCO3)N |
Computed by PubChem (NCBI)