Products 1039933-90-8
CAS 1039933-90-8 appears in our catalog under these names: 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1,3,4-oxadiazol-2-amine, 95%, 5-(2,3-Dihydrobenzo(b)(1,4)dioxin-6-yl)-1,3,4-oxadiazol-2-amine, 97%, 5-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1,3,4-oxadiazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 2,5g.
5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3,4-oxadiazol-2-amine (CAS 1039933-90-8) is a chemical compound with the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. IUPAC name: 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3,4-oxadiazol-2-amine. InChIKey: OGKQGHXOQYDRAM-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O3 |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3,4-oxadiazol-2-amine |
| InChIKey | OGKQGHXOQYDRAM-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C3=NN=C(O3)N |
Computed by PubChem (NCBI)