CAS 78875-00-0 is the registry number for 3-Ethyl-6-nitroquinazolin-4(3h)-one, 98%. Offered by: Combi-blocks. Available pack sizes: 500mg, 1g.
3-ethyl-6-nitroquinazolin-4-one (CAS 78875-00-0) is a chemical compound with the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. IUPAC name: 3-ethyl-6-nitroquinazolin-4-one. InChIKey: YGHZIYFKMZBUQU-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O3 |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | 3-ethyl-6-nitroquinazolin-4-one |
| InChIKey | YGHZIYFKMZBUQU-UHFFFAOYSA-N |
| SMILES | CCN1C=NC2=C(C1=O)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)