CAS 1193389-83-1 appears in our catalog under these names: 3-Methyl-5-(4-methyl-3-nitrophenyl)-1,2,4-oxadiazole, 95%, 3-Methyl-5-(4-methyl-3-nitrophenyl)-1,2,4-oxadiazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-methyl-5-(4-methyl-3-nitrophenyl)-1,2,4-oxadiazole (CAS 1193389-83-1) is a chemical compound with the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. IUPAC name: 3-methyl-5-(4-methyl-3-nitrophenyl)-1,2,4-oxadiazole. InChIKey: USPMRIWEEJXOOE-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O3 |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | 3-methyl-5-(4-methyl-3-nitrophenyl)-1,2,4-oxadiazole |
| InChIKey | USPMRIWEEJXOOE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NC(=NO2)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)