Products 51672-79-8

CAS 51672-79-8 is the registry number for 3-(4-Oxo-1,2,3-benzotriazin-3(4h)-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid (CAS 51672-79-8) is a chemical compound with the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. IUPAC name: 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid. InChIKey: AHKDQGZBLDBPNI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9N3O3
Molecular weight219.20 g/mol
IUPAC name3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid
InChIKeyAHKDQGZBLDBPNI-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)N(N=N2)CCC(=O)O

Computed by PubChem (NCBI)