CAS 51672-79-8 is the registry number for 3-(4-Oxo-1,2,3-benzotriazin-3(4h)-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid (CAS 51672-79-8) is a chemical compound with the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. IUPAC name: 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid. InChIKey: AHKDQGZBLDBPNI-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O3 |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | 3-(4-oxo-1,2,3-benzotriazin-3-yl)propanoic acid |
| InChIKey | AHKDQGZBLDBPNI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(N=N2)CCC(=O)O |
Computed by PubChem (NCBI)