CAS 197083-26-4 is the registry number for (1E)-2-(1,3-Dioxo-1,3-dihydro-2h-isoindol-2-yl)-n'-hydroxyethanimidamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
2-(1,3-dioxoisoindol-2-yl)-N'-hydroxyethanimidamide (CAS 197083-26-4) is a chemical compound with the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)-N'-hydroxyethanimidamide. InChIKey: QIXPXIOYUGOPQZ-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O3 |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)-N'-hydroxyethanimidamide |
| InChIKey | QIXPXIOYUGOPQZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C/C(=N\O)/N |
Computed by PubChem (NCBI)