CAS 103994-89-4 appears in our catalog under these names: 2-Bromo-4,5-difluorobenzoyl chloride, 96%, 2-Bromo-4,5-difluorobenzoyl chloride, ≥96%, ≥96%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100g.
2-bromo-4,5-difluorobenzoyl chloride (CAS 103994-89-4) is a chemical compound with the molecular formula C7H2BrClF2O and a molecular weight of 255.44 g/mol. IUPAC name: 2-bromo-4,5-difluorobenzoyl chloride. InChIKey: UFZYNSSKIDMEDS-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF2O |
|---|---|
| Molecular weight | 255.44 g/mol |
| IUPAC name | 2-bromo-4,5-difluorobenzoyl chloride |
| InChIKey | UFZYNSSKIDMEDS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)Br)C(=O)Cl |
Computed by PubChem (NCBI)