Products 103994-89-4

CAS 103994-89-4 appears in our catalog under these names: 2-Bromo-4,5-difluorobenzoyl chloride, 96%, 2-Bromo-4,5-difluorobenzoyl chloride, ≥96%, ≥96%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100g.

Structural formula: {0} (CAS {1})

2-bromo-4,5-difluorobenzoyl chloride (CAS 103994-89-4) is a chemical compound with the molecular formula C7H2BrClF2O and a molecular weight of 255.44 g/mol. IUPAC name: 2-bromo-4,5-difluorobenzoyl chloride. InChIKey: UFZYNSSKIDMEDS-UHFFFAOYSA-N.

Identity
Molecular formulaC7H2BrClF2O
Molecular weight255.44 g/mol
IUPAC name2-bromo-4,5-difluorobenzoyl chloride
InChIKeyUFZYNSSKIDMEDS-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1F)F)Br)C(=O)Cl

Computed by PubChem (NCBI)