Products 123942-09-6
CAS 123942-09-6 appears in our catalog under these names: 4-Bromo-2,5-difluorobenzoic acid chloride, 95%, 4-Bromo-2,5-difluorobenzoyl chloride 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 100mg.
4-bromo-2,5-difluorobenzoyl chloride (CAS 123942-09-6) is a chemical compound with the molecular formula C7H2BrClF2O and a molecular weight of 255.44 g/mol. IUPAC name: 4-bromo-2,5-difluorobenzoyl chloride. InChIKey: OHDBFYOULUGQKS-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF2O |
|---|---|
| Molecular weight | 255.44 g/mol |
| IUPAC name | 4-bromo-2,5-difluorobenzoyl chloride |
| InChIKey | OHDBFYOULUGQKS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)F)C(=O)Cl |
Computed by PubChem (NCBI)