CAS 2375918-40-2 is the registry number for 3-Bromo-2-chloro-5,6-difluorobenzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-2-chloro-5,6-difluorobenzaldehyde (CAS 2375918-40-2) is a chemical compound with the molecular formula C7H2BrClF2O and a molecular weight of 255.44 g/mol. IUPAC name: 3-bromo-2-chloro-5,6-difluorobenzaldehyde. InChIKey: UOQCMEXZUWWBIN-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF2O |
|---|---|
| Molecular weight | 255.44 g/mol |
| IUPAC name | 3-bromo-2-chloro-5,6-difluorobenzaldehyde |
| InChIKey | UOQCMEXZUWWBIN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Cl)C=O)F)F |
Computed by PubChem (NCBI)