Products 1160573-22-7
CAS 1160573-22-7 appears in our catalog under these names: 6-Bromo-3-chloro-2,4-difluorobenzaldehyde, 6-Bromo-3-chloro-2,4-difluorobenzaldehyde, ≥95%, ≥95%. Offered by: Biosynth, Chemat. Available pack sizes: 2,5g, 250mg, 1g.
6-bromo-3-chloro-2,4-difluorobenzaldehyde (CAS 1160573-22-7) is a chemical compound with the molecular formula C7H2BrClF2O and a molecular weight of 255.44 g/mol. IUPAC name: 6-bromo-3-chloro-2,4-difluorobenzaldehyde. InChIKey: DRKDSVOIFMRTJR-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF2O |
|---|---|
| Molecular weight | 255.44 g/mol |
| IUPAC name | 6-bromo-3-chloro-2,4-difluorobenzaldehyde |
| InChIKey | DRKDSVOIFMRTJR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)C=O)F)Cl)F |
Computed by PubChem (NCBI)