Products 1263376-89-1
CAS 1263376-89-1 appears in our catalog under these names: 3-Bromo-2,6-difluorobenzoyl chloride, 95%, 3-Bromo-2,6-difluorobenzoyl chloride, 98%, 3-Brom-2.6-difluor-benzoesaeurechlorid, ≥95%, ≥95%, 3-BROMO-2,6-DIFLUOROBENZOYL CHLORIDE, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
3-bromo-2,6-difluorobenzoyl chloride (CAS 1263376-89-1) is a chemical compound with the molecular formula C7H2BrClF2O and a molecular weight of 255.44 g/mol. IUPAC name: 3-bromo-2,6-difluorobenzoyl chloride. InChIKey: OYEKTFNTUYRFBD-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF2O |
|---|---|
| Molecular weight | 255.44 g/mol |
| IUPAC name | 3-bromo-2,6-difluorobenzoyl chloride |
| InChIKey | OYEKTFNTUYRFBD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)Cl)F)Br |
Computed by PubChem (NCBI)