Products 1039960-86-5
CAS 1039960-86-5 is the registry number for 4-(Chloromethyl)-2-fluoro-1-(2-fluorophenoxy)benzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(chloromethyl)-2-fluoro-1-(2-fluorophenoxy)benzene (CAS 1039960-86-5) is a chemical compound with the molecular formula C13H9ClF2O and a molecular weight of 254.66 g/mol. IUPAC name: 4-(chloromethyl)-2-fluoro-1-(2-fluorophenoxy)benzene. InChIKey: HBFMKZAKGYXTAB-UHFFFAOYSA-N.
| Molecular formula | C13H9ClF2O |
|---|---|
| Molecular weight | 254.66 g/mol |
| IUPAC name | 4-(chloromethyl)-2-fluoro-1-(2-fluorophenoxy)benzene |
| InChIKey | HBFMKZAKGYXTAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC2=C(C=C(C=C2)CCl)F)F |
Computed by PubChem (NCBI)