CAS 104-23-4 appears in our catalog under these names: 4'-Aminoazobenzene-4-sulphonic acid, 4'-Aminoazobenzene-4-sulphonic acid, 97%, 4-((4-aminophenyl)diazenyl)benzenesulfonic acid, 4-((4-Aminophenyl)diazenyl)benzenesulfonic acid, 97%, 4-((4-Aminophenyl)diazenyl)benzenesulfonic acid, 97%, 97%. Offered by: MedChemExpress, Combi-blocks, Fluorochem, AmBeed, Chemat. Available pack sizes: Get quote, 25g, 5g, 100g, 1g, 250mg, 2.5kg, 500g.
4-[(4-aminophenyl)diazenyl]benzenesulfonic acid (CAS 104-23-4) is a chemical compound with the molecular formula C12H11N3O3S and a molecular weight of 277.30 g/mol. IUPAC name: 4-[(4-aminophenyl)diazenyl]benzenesulfonic acid. InChIKey: PPVRMPPLECDING-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O3S |
|---|---|
| Molecular weight | 277.30 g/mol |
| IUPAC name | 4-[(4-aminophenyl)diazenyl]benzenesulfonic acid |
| InChIKey | PPVRMPPLECDING-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)N=NC2=CC=C(C=C2)S(=O)(=O)O |
Computed by PubChem (NCBI)