CAS 1142209-41-3 is the registry number for 3-[5-(Anilinocarbonyl)-1,3,4-thiadiazol-2-yl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[5-(phenylcarbamoyl)-1,3,4-thiadiazol-2-yl]propanoic acid (CAS 1142209-41-3) is a chemical compound with the molecular formula C12H11N3O3S and a molecular weight of 277.30 g/mol. IUPAC name: 3-[5-(phenylcarbamoyl)-1,3,4-thiadiazol-2-yl]propanoic acid. InChIKey: CFBBVAKTGBLVAN-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O3S |
|---|---|
| Molecular weight | 277.30 g/mol |
| IUPAC name | 3-[5-(phenylcarbamoyl)-1,3,4-thiadiazol-2-yl]propanoic acid |
| InChIKey | CFBBVAKTGBLVAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=NN=C(S2)CCC(=O)O |
Computed by PubChem (NCBI)