Products 1142209-41-3

CAS 1142209-41-3 is the registry number for 3-[5-(Anilinocarbonyl)-1,3,4-thiadiazol-2-yl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-[5-(phenylcarbamoyl)-1,3,4-thiadiazol-2-yl]propanoic acid (CAS 1142209-41-3) is a chemical compound with the molecular formula C12H11N3O3S and a molecular weight of 277.30 g/mol. IUPAC name: 3-[5-(phenylcarbamoyl)-1,3,4-thiadiazol-2-yl]propanoic acid. InChIKey: CFBBVAKTGBLVAN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11N3O3S
Molecular weight277.30 g/mol
IUPAC name3-[5-(phenylcarbamoyl)-1,3,4-thiadiazol-2-yl]propanoic acid
InChIKeyCFBBVAKTGBLVAN-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)NC(=O)C2=NN=C(S2)CCC(=O)O

Computed by PubChem (NCBI)