CAS 401637-64-7 is the registry number for (2-[(Anilinocarbonyl)amino]-1,3-thiazol-4-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
2-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]acetic acid (CAS 401637-64-7) is a chemical compound with the molecular formula C12H11N3O3S and a molecular weight of 277.30 g/mol. IUPAC name: 2-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]acetic acid. InChIKey: GTYUXBDXQSSYCR-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O3S |
|---|---|
| Molecular weight | 277.30 g/mol |
| IUPAC name | 2-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | GTYUXBDXQSSYCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)NC2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)