Products 401637-64-7

CAS 401637-64-7 is the registry number for (2-[(Anilinocarbonyl)amino]-1,3-thiazol-4-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]acetic acid (CAS 401637-64-7) is a chemical compound with the molecular formula C12H11N3O3S and a molecular weight of 277.30 g/mol. IUPAC name: 2-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]acetic acid. InChIKey: GTYUXBDXQSSYCR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11N3O3S
Molecular weight277.30 g/mol
IUPAC name2-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]acetic acid
InChIKeyGTYUXBDXQSSYCR-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)NC(=O)NC2=NC(=CS2)CC(=O)O

Computed by PubChem (NCBI)