CAS 339240-01-6 is the registry number for 4-Oxo-4-((5-phenyl-1,3,4-thiadiazol-2-yl)amino)butanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-oxo-4-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]butanoic acid (CAS 339240-01-6) is a chemical compound with the molecular formula C12H11N3O3S and a molecular weight of 277.30 g/mol. IUPAC name: 4-oxo-4-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]butanoic acid. InChIKey: JBHZCNZCQPNDNW-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O3S |
|---|---|
| Molecular weight | 277.30 g/mol |
| IUPAC name | 4-oxo-4-[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]butanoic acid |
| InChIKey | JBHZCNZCQPNDNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(S2)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)