Products 685106-60-9
CAS 685106-60-9 is the registry number for 4-Oxo-5-(thiophen-2-ylmethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-oxo-5-(thiophen-2-ylmethyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-3-carboxylic acid (CAS 685106-60-9) is a chemical compound with the molecular formula C12H11N3O3S and a molecular weight of 277.30 g/mol. IUPAC name: 4-oxo-5-(thiophen-2-ylmethyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-3-carboxylic acid. InChIKey: BWJGJLSWBBBNFM-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O3S |
|---|---|
| Molecular weight | 277.30 g/mol |
| IUPAC name | 4-oxo-5-(thiophen-2-ylmethyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-3-carboxylic acid |
| InChIKey | BWJGJLSWBBBNFM-UHFFFAOYSA-N |
| SMILES | C1CN2C(=C(C=N2)C(=O)O)C(=O)N1CC3=CC=CS3 |
Computed by PubChem (NCBI)