CAS 1040033-65-5 appears in our catalog under these names: 2-Ethyl-1,1,3-trioxo-2,3-dihydro-1,2-benzothiazole-6-carboxylic acid, 95%, 2-​Ethyl-​2,​3-​dihydro-​3-​oxo-1,​2-​benzisothiazole-​6-​carboxylic acid 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-ethyl-1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid (CAS 1040033-65-5) is a chemical compound with the molecular formula C10H9NO5S and a molecular weight of 255.25 g/mol. IUPAC name: 2-ethyl-1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid. InChIKey: ITXJWRLNYSGFTE-UHFFFAOYSA-N.
| Molecular formula | C10H9NO5S |
|---|---|
| Molecular weight | 255.25 g/mol |
| IUPAC name | 2-ethyl-1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid |
| InChIKey | ITXJWRLNYSGFTE-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C2=C(S1(=O)=O)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)