CAS 178755-54-9 is the registry number for 2-(1,1-Dioxido-3-oxo-1,2-benzisothiazol-2(3H)-yl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoic acid (CAS 178755-54-9) is a chemical compound with the molecular formula C10H9NO5S and a molecular weight of 255.25 g/mol. IUPAC name: 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoic acid. InChIKey: QXJJZZQKDCRNJJ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO5S |
|---|---|
| Molecular weight | 255.25 g/mol |
| IUPAC name | 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanoic acid |
| InChIKey | QXJJZZQKDCRNJJ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)N1C(=O)C2=CC=CC=C2S1(=O)=O |
Computed by PubChem (NCBI)