CAS 590376-34-4 is the registry number for 4-([3-(Methoxycarbonyl)thien-2-yl]amino)-4-oxobut-2-enoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(Z)-4-[(3-methoxycarbonylthiophen-2-yl)amino]-4-oxobut-2-enoic acid (CAS 590376-34-4) is a chemical compound with the molecular formula C10H9NO5S and a molecular weight of 255.25 g/mol. IUPAC name: (Z)-4-[(3-methoxycarbonylthiophen-2-yl)amino]-4-oxobut-2-enoic acid. InChIKey: SKNMQRTWOSRRPT-IHWYPQMZSA-N.
| Molecular formula | C10H9NO5S |
|---|---|
| Molecular weight | 255.25 g/mol |
| IUPAC name | (Z)-4-[(3-methoxycarbonylthiophen-2-yl)amino]-4-oxobut-2-enoic acid |
| InChIKey | SKNMQRTWOSRRPT-IHWYPQMZSA-N |
| SMILES | COC(=O)C1=C(SC=C1)NC(=O)/C=C\C(=O)O |
Computed by PubChem (NCBI)