Products 29209-29-8

CAS 29209-29-8 is the registry number for Methyl C4-oxophenylalaninate 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 1,1,4-trioxo-2,3-dihydro-1lambda6,2-benzothiazine-3-carboxylate (CAS 29209-29-8) is a chemical compound with the molecular formula C10H9NO5S and a molecular weight of 255.25 g/mol. IUPAC name: methyl 1,1,4-trioxo-2,3-dihydro-1lambda6,2-benzothiazine-3-carboxylate. InChIKey: HJAKVQDJSUIRPK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO5S
Molecular weight255.25 g/mol
IUPAC namemethyl 1,1,4-trioxo-2,3-dihydro-1lambda6,2-benzothiazine-3-carboxylate
InChIKeyHJAKVQDJSUIRPK-UHFFFAOYSA-N
SMILESCOC(=O)C1C(=O)C2=CC=CC=C2S(=O)(=O)N1

Computed by PubChem (NCBI)