CAS 29209-29-8 is the registry number for Methyl C4-oxophenylalaninate 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1,1,4-trioxo-2,3-dihydro-1lambda6,2-benzothiazine-3-carboxylate (CAS 29209-29-8) is a chemical compound with the molecular formula C10H9NO5S and a molecular weight of 255.25 g/mol. IUPAC name: methyl 1,1,4-trioxo-2,3-dihydro-1lambda6,2-benzothiazine-3-carboxylate. InChIKey: HJAKVQDJSUIRPK-UHFFFAOYSA-N.
| Molecular formula | C10H9NO5S |
|---|---|
| Molecular weight | 255.25 g/mol |
| IUPAC name | methyl 1,1,4-trioxo-2,3-dihydro-1lambda6,2-benzothiazine-3-carboxylate |
| InChIKey | HJAKVQDJSUIRPK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1C(=O)C2=CC=CC=C2S(=O)(=O)N1 |
Computed by PubChem (NCBI)