CAS 88741-92-8 appears in our catalog under these names: Piroxicam Impurity 13, 4-Hydroxy-2-methyl-2H-1,2-benzothiazine-3-carboxylic Acid, 1,1-Dioxide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
4-hydroxy-2-methyl-1,1-dioxo-1lambda6,2-benzothiazine-3-carboxylic acid (CAS 88741-92-8) is a chemical compound with the molecular formula C10H9NO5S and a molecular weight of 255.25 g/mol. IUPAC name: 4-hydroxy-2-methyl-1,1-dioxo-1lambda6,2-benzothiazine-3-carboxylic acid. InChIKey: HTZOXRHYFAORSJ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO5S |
|---|---|
| Molecular weight | 255.25 g/mol |
| IUPAC name | 4-hydroxy-2-methyl-1,1-dioxo-1lambda6,2-benzothiazine-3-carboxylic acid |
| InChIKey | HTZOXRHYFAORSJ-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C2=CC=CC=C2S1(=O)=O)O)C(=O)O |
Computed by PubChem (NCBI)