CAS 1040084-01-2 appears in our catalog under these names: 4-(2,3-Dichlorophenoxy)benzoic acid, 95%, 4-(2,3-Dichlorophenoxy)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-(2,3-dichlorophenoxy)benzoic acid (CAS 1040084-01-2) is a chemical compound with the molecular formula C13H8Cl2O3 and a molecular weight of 283.10 g/mol. IUPAC name: 4-(2,3-dichlorophenoxy)benzoic acid. InChIKey: ACGDYYPHNSLNSS-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O3 |
|---|---|
| Molecular weight | 283.10 g/mol |
| IUPAC name | 4-(2,3-dichlorophenoxy)benzoic acid |
| InChIKey | ACGDYYPHNSLNSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)OC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)