CAS 76093-25-9 is the registry number for 2-Chloro-6-(2-chlorophenoxy)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-6-(2-chlorophenoxy)benzoic acid (CAS 76093-25-9) is a chemical compound with the molecular formula C13H8Cl2O3 and a molecular weight of 283.10 g/mol. IUPAC name: 2-chloro-6-(2-chlorophenoxy)benzoic acid. InChIKey: FLNREEXVEZVVFC-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O3 |
|---|---|
| Molecular weight | 283.10 g/mol |
| IUPAC name | 2-chloro-6-(2-chlorophenoxy)benzoic acid |
| InChIKey | FLNREEXVEZVVFC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC2=C(C(=CC=C2)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)