CAS 463351-44-2 is the registry number for (2E)-3-[5-(2,3-Dichlorophenyl)-2-furyl]acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoic acid (CAS 463351-44-2) is a chemical compound with the molecular formula C13H8Cl2O3 and a molecular weight of 283.10 g/mol. IUPAC name: (E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoic acid. InChIKey: LZVUGMMUAUOFEN-FNORWQNLSA-N.
| Molecular formula | C13H8Cl2O3 |
|---|---|
| Molecular weight | 283.10 g/mol |
| IUPAC name | (E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoic acid |
| InChIKey | LZVUGMMUAUOFEN-FNORWQNLSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=CC=C(O2)/C=C/C(=O)O |
Computed by PubChem (NCBI)