CAS 69199-64-0 appears in our catalog under these names: 5-Chloro-2-(3-chlorophenoxy)benzoic acid, 95%, 5-Chloro-2-(3-chlorophenoxy)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
5-chloro-2-(3-chlorophenoxy)benzoic acid (CAS 69199-64-0) is a chemical compound with the molecular formula C13H8Cl2O3 and a molecular weight of 283.10 g/mol. IUPAC name: 5-chloro-2-(3-chlorophenoxy)benzoic acid. InChIKey: KDMGEYNUMSEUKR-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O3 |
|---|---|
| Molecular weight | 283.10 g/mol |
| IUPAC name | 5-chloro-2-(3-chlorophenoxy)benzoic acid |
| InChIKey | KDMGEYNUMSEUKR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)OC2=C(C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)