Products 925005-04-5
CAS 925005-04-5 appears in our catalog under these names: 4-(2,4-Dichlorophenoxy)benzoic acid, 95%, 4-(2,4-Dichlorophenoxy)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,25g, 0,5g, 2g.
4-(2,4-dichlorophenoxy)benzoic acid (CAS 925005-04-5) is a chemical compound with the molecular formula C13H8Cl2O3 and a molecular weight of 283.10 g/mol. IUPAC name: 4-(2,4-dichlorophenoxy)benzoic acid. InChIKey: NCPJMYHBNJYQDB-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O3 |
|---|---|
| Molecular weight | 283.10 g/mol |
| IUPAC name | 4-(2,4-dichlorophenoxy)benzoic acid |
| InChIKey | NCPJMYHBNJYQDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)