CAS 10403-47-1 appears in our catalog under these names: 2–Bromo–5–nitroaniline, 2-Bromo-5-nitroaniline, 2-Bromo-5-nitroaniline, 98%, 2-Bromo-5-nitroaniline, >97.0%(GC), 2-Bromo-5-nitroaniline 98%. Offered by: GLPBio, Biosynth, Thermo Scientific (Acros), TCI, Ambeed. Available pack sizes: 100g, 25g, 0,1kg, 0,25kg, 5g, 1g, 10g, 500g.
2-bromo-5-nitroaniline (CAS 10403-47-1) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 2-bromo-5-nitroaniline. InChIKey: BAAUCXCLMDAZEL-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 2-bromo-5-nitroaniline |
| InChIKey | BAAUCXCLMDAZEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])N)Br |
Computed by PubChem (NCBI)