Products 1040379-11-0
CAS 1040379-11-0 is the registry number for 3,3',5,5'-Tetramethyl-biphenyl-2,2',6,6'-tetraol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(2,6-dihydroxy-3,5-dimethylphenyl)-4,6-dimethylbenzene-1,3-diol (CAS 1040379-11-0) is a chemical compound with the molecular formula C16H18O4 and a molecular weight of 274.31 g/mol. IUPAC name: 2-(2,6-dihydroxy-3,5-dimethylphenyl)-4,6-dimethylbenzene-1,3-diol. InChIKey: VGHDWFSSPHGQDJ-UHFFFAOYSA-N.
| Molecular formula | C16H18O4 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | 2-(2,6-dihydroxy-3,5-dimethylphenyl)-4,6-dimethylbenzene-1,3-diol |
| InChIKey | VGHDWFSSPHGQDJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1O)C2=C(C(=CC(=C2O)C)C)O)O)C |
Computed by PubChem (NCBI)