CAS 13990-86-8 appears in our catalog under these names: 3,3'-Dimethoxy-5,5'-dimethylbiphenyl-2,2'-diol, 95%, 3,3'–dimethoxy–5,5'–dimethyl–(1,1'–biphenyl)–2,2'–diol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
2-(2-hydroxy-3-methoxy-5-methylphenyl)-6-methoxy-4-methylphenol (CAS 13990-86-8) is a chemical compound with the molecular formula C16H18O4 and a molecular weight of 274.31 g/mol. IUPAC name: 2-(2-hydroxy-3-methoxy-5-methylphenyl)-6-methoxy-4-methylphenol. InChIKey: QXKAEQCGFVTAMN-UHFFFAOYSA-N.
| Molecular formula | C16H18O4 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | 2-(2-hydroxy-3-methoxy-5-methylphenyl)-6-methoxy-4-methylphenol |
| InChIKey | QXKAEQCGFVTAMN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)OC)O)C2=C(C(=CC(=C2)C)OC)O |
Computed by PubChem (NCBI)