CAS 565192-81-6 appears in our catalog under these names: 3-Methyl-5-(3-oxo-butyl)-benzofuran-2-carboxylic acid ethyl ester, 95%, Ethyl 3-methyl-5-(3-oxobutyl)-1-benzofuran-2-carboxylate, 95%, Ethyl 3-methyl-5-(3-oxobutyl)-1-benzofuran-2-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
Ethyl 3-methyl-5-(3-oxobutyl)-1-benzofuran-2-carboxylate (CAS 565192-81-6) is a chemical compound with the molecular formula C16H18O4 and a molecular weight of 274.31 g/mol. IUPAC name: ethyl 3-methyl-5-(3-oxobutyl)-1-benzofuran-2-carboxylate. InChIKey: OZSPYDDURRSTEG-UHFFFAOYSA-N.
| Molecular formula | C16H18O4 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | ethyl 3-methyl-5-(3-oxobutyl)-1-benzofuran-2-carboxylate |
| InChIKey | OZSPYDDURRSTEG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(O1)C=CC(=C2)CCC(=O)C)C |
Computed by PubChem (NCBI)