CAS 314742-07-9 is the registry number for 3,4,8-Trimethyl-7-(1-methyl-2-oxopropoxy)-2h-chromen-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3,4,8-trimethyl-7-(3-oxobutan-2-yloxy)chromen-2-one (CAS 314742-07-9) is a chemical compound with the molecular formula C16H18O4 and a molecular weight of 274.31 g/mol. IUPAC name: 3,4,8-trimethyl-7-(3-oxobutan-2-yloxy)chromen-2-one. InChIKey: UEFZSBYJVIWXML-UHFFFAOYSA-N.
| Molecular formula | C16H18O4 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | 3,4,8-trimethyl-7-(3-oxobutan-2-yloxy)chromen-2-one |
| InChIKey | UEFZSBYJVIWXML-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2C)OC(C)C(=O)C)C |
Computed by PubChem (NCBI)