CAS 307546-52-7 appears in our catalog under these names: 4-Ethyl-7-methyl-5-(1-methyl-2-oxopropoxy)-2h-chromen-2-one, 95%, 4-Ethyl-7-methyl-5-(1-methyl-2-oxopropoxy)-2H-chromen-2-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g.
4-ethyl-7-methyl-5-(3-oxobutan-2-yloxy)chromen-2-one (CAS 307546-52-7) is a chemical compound with the molecular formula C16H18O4 and a molecular weight of 274.31 g/mol. IUPAC name: 4-ethyl-7-methyl-5-(3-oxobutan-2-yloxy)chromen-2-one. InChIKey: WBHWJTKSRIWMKN-UHFFFAOYSA-N.
| Molecular formula | C16H18O4 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | 4-ethyl-7-methyl-5-(3-oxobutan-2-yloxy)chromen-2-one |
| InChIKey | WBHWJTKSRIWMKN-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=O)OC2=C1C(=CC(=C2)C)OC(C)C(=O)C |
Computed by PubChem (NCBI)