CAS 104077-15-8 is the registry number for 6,7-Dimethoxy-4-methyl-3-oxo-3,4-dihydroquinoxaline-2-carbonyl Chloride. Offered by: TRC. Available pack sizes: 250mg.
6,7-dimethoxy-4-methyl-3-oxoquinoxaline-2-carbonyl chloride (CAS 104077-15-8) is a chemical compound with the molecular formula C12H11ClN2O4 and a molecular weight of 282.68 g/mol. IUPAC name: 6,7-dimethoxy-4-methyl-3-oxoquinoxaline-2-carbonyl chloride. InChIKey: HQUXEWBKFUSDKC-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O4 |
|---|---|
| Molecular weight | 282.68 g/mol |
| IUPAC name | 6,7-dimethoxy-4-methyl-3-oxoquinoxaline-2-carbonyl chloride |
| InChIKey | HQUXEWBKFUSDKC-UHFFFAOYSA-N |
| SMILES | CN1C2=CC(=C(C=C2N=C(C1=O)C(=O)Cl)OC)OC |
Computed by PubChem (NCBI)