CAS 189746-21-2 is the registry number for 5-Chloro-2,6-dimethoxy-4-methyl-8-nitroquinoline, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
5-chloro-2,6-dimethoxy-4-methyl-8-nitroquinoline (CAS 189746-21-2) is a chemical compound with the molecular formula C12H11ClN2O4 and a molecular weight of 282.68 g/mol. IUPAC name: 5-chloro-2,6-dimethoxy-4-methyl-8-nitroquinoline. InChIKey: VZVNAHCSVNVONJ-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O4 |
|---|---|
| Molecular weight | 282.68 g/mol |
| IUPAC name | 5-chloro-2,6-dimethoxy-4-methyl-8-nitroquinoline |
| InChIKey | VZVNAHCSVNVONJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C(=C(C=C2[N+](=O)[O-])OC)Cl)OC |
Computed by PubChem (NCBI)