CAS 1910769-52-6 is the registry number for [1-(4-Chlorobenzyl)-2,5-dioxoimidazolidin-4-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[1-[(4-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetic acid (CAS 1910769-52-6) is a chemical compound with the molecular formula C12H11ClN2O4 and a molecular weight of 282.68 g/mol. IUPAC name: 2-[1-[(4-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetic acid. InChIKey: AKRHSDQRCAMZJQ-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O4 |
|---|---|
| Molecular weight | 282.68 g/mol |
| IUPAC name | 2-[1-[(4-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetic acid |
| InChIKey | AKRHSDQRCAMZJQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C(=O)C(NC2=O)CC(=O)O)Cl |
Computed by PubChem (NCBI)