CAS 1173293-40-7 appears in our catalog under these names: 3-[1-(4-Chlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoic acid, 95%, 3-(1-(4-Chlorophenyl)-2,5-dioxoimidazolidin-4-yl)propanoic acid, 95%, 3-(1-(4-Chlorophenyl)-2,5-dioxoimidazolidin-4-yl)propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 2,5g.
3-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoic acid (CAS 1173293-40-7) is a chemical compound with the molecular formula C12H11ClN2O4 and a molecular weight of 282.68 g/mol. IUPAC name: 3-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoic acid. InChIKey: DNDZJFLKBPWFOG-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O4 |
|---|---|
| Molecular weight | 282.68 g/mol |
| IUPAC name | 3-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoic acid |
| InChIKey | DNDZJFLKBPWFOG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C(NC2=O)CCC(=O)O)Cl |
Computed by PubChem (NCBI)