Products 1210492-11-7
CAS 1210492-11-7 is the registry number for 1-(4-Chlorophenyl)-4-(2-hydroxyethyl)-5-oxo-2,5-dihydro-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g.
2-(4-chlorophenyl)-4-(2-hydroxyethyl)-3-oxo-1H-pyrazole-5-carboxylic acid (CAS 1210492-11-7) is a chemical compound with the molecular formula C12H11ClN2O4 and a molecular weight of 282.68 g/mol. IUPAC name: 2-(4-chlorophenyl)-4-(2-hydroxyethyl)-3-oxo-1H-pyrazole-5-carboxylic acid. InChIKey: SPJLANAYHGFDJS-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O4 |
|---|---|
| Molecular weight | 282.68 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-4-(2-hydroxyethyl)-3-oxo-1H-pyrazole-5-carboxylic acid |
| InChIKey | SPJLANAYHGFDJS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C(=C(N2)C(=O)O)CCO)Cl |
Computed by PubChem (NCBI)