CAS 1040877-93-7 is the registry number for Methyl 1-(phenylsulfonyl)piperidine-3-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 1-(benzenesulfonyl)piperidine-3-carboxylate (CAS 1040877-93-7) is a chemical compound with the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. IUPAC name: methyl 1-(benzenesulfonyl)piperidine-3-carboxylate. InChIKey: LJAGGVMEZREQAE-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4S |
|---|---|
| Molecular weight | 283.35 g/mol |
| IUPAC name | methyl 1-(benzenesulfonyl)piperidine-3-carboxylate |
| InChIKey | LJAGGVMEZREQAE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCCN(C1)S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)