Products 104089-72-7
CAS 104089-72-7 is the registry number for (2Z)-2-(4-Chlorophenyl)-3-(3-nitrophenyl)acrylonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(Z)-2-(4-chlorophenyl)-3-(3-nitrophenyl)prop-2-enenitrile (CAS 104089-72-7) is a chemical compound with the molecular formula C15H9ClN2O2 and a molecular weight of 284.69 g/mol. IUPAC name: (Z)-2-(4-chlorophenyl)-3-(3-nitrophenyl)prop-2-enenitrile. InChIKey: RTDWPLYDMXBIEL-MDWZMJQESA-N.
| Molecular formula | C15H9ClN2O2 |
|---|---|
| Molecular weight | 284.69 g/mol |
| IUPAC name | (Z)-2-(4-chlorophenyl)-3-(3-nitrophenyl)prop-2-enenitrile |
| InChIKey | RTDWPLYDMXBIEL-MDWZMJQESA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])/C=C(\C#N)/C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)