Products 667412-62-6
CAS 667412-62-6 appears in our catalog under these names: 6-Chloro-2-pyridin-2-ylquinoline-4-carboxylic acid, 95%, 6-Chloro-2-(pyridin-2-yl)quinoline-4-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6-chloro-2-pyridin-2-ylquinoline-4-carboxylic acid (CAS 667412-62-6) is a chemical compound with the molecular formula C15H9ClN2O2 and a molecular weight of 284.69 g/mol. IUPAC name: 6-chloro-2-pyridin-2-ylquinoline-4-carboxylic acid. InChIKey: WPDNUGLTULFDQJ-UHFFFAOYSA-N.
| Molecular formula | C15H9ClN2O2 |
|---|---|
| Molecular weight | 284.69 g/mol |
| IUPAC name | 6-chloro-2-pyridin-2-ylquinoline-4-carboxylic acid |
| InChIKey | WPDNUGLTULFDQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC3=C(C=C(C=C3)Cl)C(=C2)C(=O)O |
Computed by PubChem (NCBI)