CAS 1417367-13-5 is the registry number for 4-[(2-Chloropyridin-3-yl)methylene]-2-phenyl-1,3-oxazol-5(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(4Z)-4-[(2-chloro-3-pyridinyl)methylidene]-2-phenyl-1,3-oxazol-5-one (CAS 1417367-13-5) is a chemical compound with the molecular formula C15H9ClN2O2 and a molecular weight of 284.69 g/mol. IUPAC name: (4Z)-4-[(2-chloro-3-pyridinyl)methylidene]-2-phenyl-1,3-oxazol-5-one. InChIKey: SMSVFZSYEFYOTM-XFXZXTDPSA-N.
| Molecular formula | C15H9ClN2O2 |
|---|---|
| Molecular weight | 284.69 g/mol |
| IUPAC name | (4Z)-4-[(2-chloro-3-pyridinyl)methylidene]-2-phenyl-1,3-oxazol-5-one |
| InChIKey | SMSVFZSYEFYOTM-XFXZXTDPSA-N |
| SMILES | C1=CC=C(C=C1)C2=N/C(=C\C3=C(N=CC=C3)Cl)/C(=O)O2 |
Computed by PubChem (NCBI)